Home
Products
2'-O-Methylphloretin (4,2',4'-Trihydroxy-6'-methoxydihydrochalcone)
| Product Name | 2'-O-Methylphloretin (4,2',4'-Trihydroxy-6'-methoxydihydrochalcone) |
| Price: | $321 / 5mg |
| Catalog No.: | CN05598 |
| CAS No.: | 111316-17-7 |
| Molecular Formula: | C16H16O5 |
| Molecular Weight: | 288.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Chalcones |
| Physical Desc.: | Powder |
| Source: | The peels of apple. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)cc(c1C(=O)CCc1ccc(cc1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Exact Mass | 288.10000 |
| PSA | 86.99000 |
| LogP | 2.62750 |