Home
Products
Ginkgolic acid C17:1
| Product Name | Ginkgolic acid C17:1 |
| Price: | $146 / 10mg |
| Catalog No.: | CN04053 |
| CAS No.: | 111047-30-4 |
| Molecular Formula: | C24H38O3 |
| Molecular Weight: | 374.56 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The leaves of Ginkgo biloba L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCC/C=CCCCCCCCCCc1cccc(c1C(=O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 499.1±33.0 °C at 760 mmHg |
| Flash Point | 269.7±21.9 °C |
| Exact Mass | 374.282104 |
| PSA | 57.53000 |
| LogP | 10.50 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |