Home
Products
Wilforine
| Product Name | Wilforine |
| Price: | $146 / 10mg |
| Catalog No.: | CN09545 |
| CAS No.: | 11088-09-8 |
| Molecular Formula: | C43H49NO18 |
| Molecular Weight: | 867.9 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The vines of Tripterygium wilfordii. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)OCC12C(OC(=O)C)C(OC(=O)c3ccccc3)C3C(C42OC(C(C(C1OC(=O)C)OC(=O)C)C4OC(=O)C)(C)COC(=O)c1cccnc1CCC(C(=O)O3)C)(C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Wilforine is a sesquiterpene pyridine alkaloid; importantbioactive compound in T. wilfordii plants, and is effective intreating idiopathic pulmonary fibrosis. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 871.5±65.0 °C at 760 mmHg |
| Flash Point | 480.9±34.3 °C |
| Exact Mass | 867.294983 |
| PSA | 252.75000 |
| LogP | 6.24 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2-8℃ |