Home
Products
trans-Beta-Apo-8'-carotenal
| Product Name | trans-Beta-Apo-8'-carotenal |
| Price: | Inquiry |
| Catalog No.: | CN06465 |
| CAS No.: | 1107-26-2 |
| Molecular Formula: | C30H40O |
| Molecular Weight: | 416.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C/C(=C/C=C/C(=C/C=C/C=C(/C=C/C=C(/C=C/C1=C(C)CCCC1(C)C)C)C)/C)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | β-Apo-8'-carotenal (Apocarotenal), a provitamin A carotenoid, is an inducer of CYPlA1 and CYPlA2 in rat. β-Apo-8'-carotenal is present in many fruits and vegetables[1]. |
| Target | CYP1A1 CYP1A2 |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 575.7±19.0 °C at 760 mmHg |
| Flash Point | 273.8±13.8 °C |
| Exact Mass | 416.307922 |
| PSA | 17.07000 |
| LogP | 9.82 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Storage condition | 2-8°C |