Home
Products
Epimedin C
| Product Name | Epimedin C |
| Price: | $62 / 20mg |
| Catalog No.: | CN05466 |
| CAS No.: | 110642-44-9 |
| Molecular Formula: | C39H50O19 |
| Molecular Weight: | 822.80 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Epimedium brevicornum Maxim |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1ccc(cc1)c1oc2c(CC=C(C)C)c(O[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)cc(c2c(=O)c1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epmedin C, a natural product, has estrogen-like effects for ovariectomized mice.IC50 value:Target:In vitro:In vivo: Anesthetized with 0.4%pentobarbital sodium, mice of the ovariectomized group were conducted with Bilateral oophorectomy, while fat beside ovaries were removed on mice of the sham-operation group. Compared with the sham-operation group, body weight of mice of model group were significantly increased, uterus weight and uterine factor and estradiol levels were significantly reduced, which suggested a significant difference. In comparison of the ovariectomized group, body weight of mice were relieved significantly and uterus weight and uterine factor and estradiol levels were increased significantly in all Epmedin C groups [1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 1062.1±65.0 °C at 760 mmHg |
| Flash Point | 322.2±27.8 °C |
| Exact Mass | 822.294617 |
| PSA | 297.12000 |
| LogP | 3.19 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |