Home
Products
Higenamine HCl
| Product Name | Higenamine HCl |
| Price: | Inquiry |
| Catalog No.: | CN01075 |
| CAS No.: | 11041-94-4 |
| Molecular Formula: | C16H18ClNO3 |
| Molecular Weight: | 307.8 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum carmichaeli Debx. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc(cc1)CC1NCCc2c1cc(O)c(c2)O.Cl |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Higenamine hydrochloride (Norcoclaurine hydrochloride), a β2-AR agonist, is a key component of the Chinese herb aconite root that prescribes for treating symptoms of heart failure in the oriental Asian countries. Higenamine hydrochloride (Norcoclaurine hydrochloride) has anti-apoptotic effects[1][2]. |
| Target | β2-AR[1] |
| Boiling Point | 522.4ºC at 760 mmHg |
| Flash Point | 209.6ºC |
| Exact Mass | 307.097534 |
| PSA | 72.72000 |
| LogP | 3.36370 |
| Vapour Pressure | 1.56E-11mmHg at 25°C |