Home
Products
Santalol
| Product Name | Santalol |
| Price: | $117 / 20mg |
| Catalog No.: | CN06493 |
| CAS No.: | 11031-45-1 |
| Molecular Formula: | C15H24O |
| Molecular Weight: | 220.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Santalum album L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC/C(=C/CC[C@@]1(C)[C@H]2CC[C@@H](C1=C)C2)/C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Santalol is a mixture of α and β-isomer santalol. α-santalol is isolated from sandalwood oil. α-santalol is a promising anti-cancer agent against cancers such as oral, breast, prostate and skin cancer[1]. |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 312.0±11.0 °C at 760 mmHg |
| Flash Point | 116.3±15.6 °C |
| Exact Mass | 220.182709 |
| PSA | 20.23000 |
| LogP | 4.87 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Storage condition | 2-8°C |