Home
Products
Digitonin
| Product Name | Digitonin |
| Price: | Inquiry |
| Catalog No.: | CN02447 |
| CAS No.: | 11024-24-1 |
| Molecular Formula: | C56H92O29 |
| Molecular Weight: | 1229.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The herbs of Digitalis purpurea |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2C[C@@H]3CC[C@@H]4[C@@H]([C@]3(C[C@H]2O)C)CC[C@]2([C@H]4[C@H](O)[C@H]3[C@@H]2[C@@H]([C@]2(O3)CC[C@H](CO2)C)C)C)[C@@H]([C@H]([C@H]1O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O[C@@H]1O[C@H](CO)[C@@H]([C@@H]([C@H]1O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O)O[C@@H]1OC[C@H]([C@@H]([C@H]1O)O)O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Digitonin, a glycoside obtained from Digitalis purpurea, could increase cell permeability by binding to cholesterol molecules and reduce tumor growth. |
| In Vitro | Digitonin, a detergent that increases cell permeability by binding to cholesterol molecules in the cell membrane, can increase cisplatin accumulation and reduce tumour growth in vitro[1]. |
| In Vivo | In the liver parenchyma the concentrations are of the same magnitude. Measured with the 133Xe-clearance technique, Digitonin does not alter the tumor blood flow. Digitonin enhances the tumor-growth retarding effect of CBDCA given intra-aterially at 5 mg/kg but not at 25 mg/kg[1]. |
| Density | 1.6±0.1 g/cm3 |
| Exact Mass | 1228.572388 |
| PSA | 454.67000 |
| LogP | -0.62 |