Home
Products
Cochliophilin A
| Product Name | Cochliophilin A |
| Price: | Inquiry |
| Catalog No.: | CN04507 |
| CAS No.: | 110204-45-0 |
| Molecular Formula: | C16H10O5 |
| Molecular Weight: | 282.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Spinacia oleracea |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=c1cc(oc2c1c(O)c1c(c2)OCO1)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 497.6±45.0 °C at 760 mmHg |
| Flash Point | 192.4±22.2 °C |
| Exact Mass | 282.052826 |
| LogP | 2.75 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |