Home
Products
12-Epinapelline
| Product Name | 12-Epinapelline |
| Price: | Inquiry |
| Catalog No.: | CN01087 |
| CAS No.: | 110064-71-6 |
| Molecular Formula: | C22H33NO3 |
| Molecular Weight: | 359.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The roots of Aconitum kusnezoffii Reichb. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCN1CC2(C)CCC(C34C1C(CC23)C12C4CC(C(C1)C(=C)C2O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 12-Epinapelline is a diterpene alkaloid isolated from Aconitum baikalense. 12-Epinapelline exhibits Anti-inflammatory activity and stimulates the growth of colonies from fibroblast precursors[1][2]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 537.8±50.0 °C at 760 mmHg |
| Flash Point | 284.2±28.8 °C |
| Exact Mass | 359.246033 |
| PSA | 63.93000 |
| LogP | 0.78 |
| Vapour Pressure | 0.0±3.2 mmHg at 25°C |