Home
Products
Neocryptotanshinone
| Product Name | Neocryptotanshinone |
| Price: | $584 / 10mg |
| Catalog No.: | CN08621 |
| CAS No.: | 109664-02-0 |
| Molecular Formula: | C19H22O4 |
| Molecular Weight: | 314.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The roots of Salvia miltiorrhiza Bge. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC[C@@H](C1=C(O)C(=O)c2c(C1=O)ccc1c2CCCC1(C)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neocryptotanshinone, a fatty diterpenoids from Salvia Miltiorrhiza, inhibits lipopolysaccharide-induced inflammation by suppression of NF-κB and iNOS signaling pathways[1][2]. |
| Density | 1.255g/cm3 |
| Boiling Point | 505.3ºC at 760 mmHg |
| Flash Point | 273.5ºC |
| Exact Mass | 314.15200 |
| PSA | 74.60000 |
| LogP | 2.96340 |
| Vapour Pressure | 4.93E-11mmHg at 25°C |