Home
Products
Pinocembrin 7-acetate
| Product Name | Pinocembrin 7-acetate |
| Price: | Inquiry |
| Catalog No.: | CN05581 |
| CAS No.: | 109592-60-1 |
| Molecular Formula: | C17H14O5 |
| Molecular Weight: | 298.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Pinus armandii |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=O)Oc1cc2O[C@@H](CC(=O)c2c(c1)O)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 525.6±50.0 °C at 760 mmHg |
| Flash Point | 197.6±23.6 °C |
| Exact Mass | 298.084137 |
| PSA | 72.83000 |
| LogP | 4.18 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |