Home
Products
Neocurdione
| Product Name | Neocurdione |
| Price: | Inquiry |
| Catalog No.: | CN09042 |
| CAS No.: | 108944-67-8 |
| Molecular Formula: | C15H24O2 |
| Molecular Weight: | 236.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Curcuma zedoaria |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=CCC[C@H](C)C(=O)C[C@@H](C(=O)C1)C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Neocurdione is a hepatoprotective sesquiterpene isolated from Curcuma zedoaria rhizome. Neocurdione exerts potent effect on D-galactosamine- (D-Gain) and lipopolysaccharide- (LPS) induced acute liver injury in mice[1]. |
| Exact Mass | 236.17800 |
| PSA | 34.14000 |
| LogP | 3.55320 |