Home
Products
Dendrophenol
| Product Name | Dendrophenol |
| Price: | Inquiry |
| Catalog No.: | CN03457 |
| CAS No.: | 108853-14-1 |
| Molecular Formula: | C17H20O5 |
| Molecular Weight: | 304.34 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The herbs of Dendrobium moscatum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(CCc2cc(OC)c(c(c2)OC)O)ccc1O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Dendrophenol, isolated from the stem of Dendrobium loddigesii Rolfe, act as a NF-κB inhibitor[1]. Antineoplastic activity[1]. |
| Target | NF-κB |
| Density | 1.208±0.06 g/cm3 (20 ºC 760 Torr) |
| Boiling Point | 459.6±40.0 °C at 760 mmHg |
| Flash Point | 231.7±27.3 °C |
| Exact Mass | 304.131073 |
| PSA | 68.15000 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |