Home
Products
Isomeranzin
| Product Name | Isomeranzin |
| Price: | $439 / 10mg |
| Catalog No.: | CN06318 |
| CAS No.: | 1088-17-1 |
| Molecular Formula: | C15H16O4 |
| Molecular Weight: | 260.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The peels of Citrus maxima |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1ccc2c(c1CC(=O)C(C)C)oc(=O)cc2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Isomerazin is a coumarin isolated from Poncirus trifoliate Raf., and shows cholinesterase inhibition[1][2]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 423.4±45.0 °C at 760 mmHg |
| Flash Point | 188.9±28.8 °C |
| Exact Mass | 260.104858 |
| PSA | 56.51000 |
| LogP | 1.88 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |