Home
Products
Eupalinolide K
| Product Name | Eupalinolide K |
| Price: | $321 / 5mg |
| Catalog No.: | CN09532 |
| CAS No.: | 108657-10-9 |
| Molecular Formula: | C20H26O6 |
| Molecular Weight: | 362.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Sesquiterpenoids |
| Physical Desc.: | Powder |
| Source: | The aerial parts of Eupatorium lindleyanum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OCC=C(C(=O)OC1CC(=CCC(C(=CC2C1C(=C)C(=O)O2)C)O)C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Eupalinolide K, a sesquiterpene lactones compound from Eupatorium lindleyanum, is a STAT3 inhibitor. Eupalinolide K is a Michael reaction acceptor (MRA) [1]. |
| Target | STAT3 |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 574.4±50.0 °C at 760 mmHg |
| Flash Point | 201.5±23.6 °C |
| Exact Mass | 362.172943 |
| PSA | 93.06000 |
| LogP | 2.29 |
| Vapour Pressure | 0.0±3.6 mmHg at 25°C |