Home
Products
Lumichrome
| Product Name | Lumichrome |
| Price: | Inquiry |
| Catalog No.: | CN00907 |
| CAS No.: | 1086-80-2 |
| Molecular Formula: | C12H10N4O2 |
| Molecular Weight: | 242.23 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The aerial parts of Isodon excisoides. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Cc1cc2nc3c(nc2cc1C)[nH]c(=O)[nH]c3=O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Lumichrome, a photodegradation product of Riboflavin, is an endogenous compound in humans. Lumichrome inhibits human lung cancer cell growth and induces apoptosis via a p53-dependent mechanism[1][2]. |
| Target | Human Endogenous Metabolite |
| Density | 1.388g/cm3 |
| Exact Mass | 242.08000 |
| PSA | 91.50000 |
| LogP | 0.77640 |