Home
Products
3,6-Dihydroxyflavone
| Product Name | 3,6-Dihydroxyflavone |
| Price: | Inquiry |
| Catalog No.: | CN04396 |
| CAS No.: | 108238-41-1 |
| Molecular Formula: | C15H10O4 |
| Molecular Weight: | 254.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Sphagneticola trilobata |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1ccc2c(c1)c(=O)c(c(o2)c1ccccc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3,6-Dihydroxyflavone is an anti-cancer agent. 3,6-Dihydroxyflavone dose- and time-dependently decreases cell viability and induces apoptosis by activating caspase cascade, cleaving poly (ADP-ribose) polymerase (PARP). 3,6-Dihydroxyflavone increases intracellular oxidative stress and lipid peroxidation[1]. |
| Density | 1.472g/cm3 |
| Boiling Point | 477.1ºC at 760 mmHg |
| Flash Point | 186.2ºC |
| Exact Mass | 254.05800 |
| PSA | 70.67000 |
| LogP | 2.87120 |
| Vapour Pressure | 6.55E-10mmHg at 25°C |