Home
Products
alpha-Terthiophene
| Product Name | alpha-Terthiophene |
| Price: | $77 / 20mg |
| Catalog No.: | CN06367 |
| CAS No.: | 1081-34-1 |
| Molecular Formula: | C12H8S3 |
| Molecular Weight: | 248.38 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Tagetes minuta |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | c1csc(c1)c1ccc(s1)c1cccs1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 2,2':5',2''-Terthiophene (α-Terthiophene) is an oligomer of the heterocycle thiophene. 2,2':5',2''-Terthiophene has been employed as building block for the organic semi-conductor polythiophene. |
| In Vitro | In the most common isomer of Terthiophene, two thienyl groups are connected via their 2 positions to a central thiophene, also at the carbon atoms flanking the sulfur. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 361.3±32.0 °C at 760 mmHg |
| Flash Point | 128.4±11.3 °C |
| Exact Mass | 247.978806 |
| PSA | 84.72000 |
| LogP | 5.56 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Storage condition | 2-8°C |