Home
Products
3-Methylxanthine
| Product Name | 3-Methylxanthine |
| Price: | Inquiry |
| Catalog No.: | CN00746 |
| CAS No.: | 1076-22-8 |
| Molecular Formula: | C6H6N4O2 |
| Molecular Weight: | 166.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The fruits of Theobroma cacao L. |
| Solvent: | DMSO, Pyridine, etc. |
| SMILES: | O=c1[nH]c(=O)c2c(n1C)nc[nH]2 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 3-Methylxanthine, a xanthine derivative, is a cyclic guanosine monophosphate (GMP) inhibitor, with an IC50 of 920 μM on guinea-pig isolated trachealis muscle. |
| Target | GMP:920 μM (IC50) Human Endogenous Metabolite |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 322.4ºC at 760 mmHg |
| Flash Point | 148.8ºC |
| Exact Mass | 166.049072 |
| PSA | 83.54000 |
| LogP | -0.79 |
| Vapour Pressure | 2.23E-05mmHg at 25°C |
| Storage condition | 2-8°C |