Home
Products
Garcinone D
| Product Name | Garcinone D |
| Price: | $146 / 10mg |
| Catalog No.: | CN05795 |
| CAS No.: | 107390-08-9 |
| Molecular Formula: | C24H28O7 |
| Molecular Weight: | 428.48 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Yellow powder |
| Source: | The fruits of Garcinia mangostana |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1c(O)cc2c(c1CCC(O)(C)C)c(=O)c1c(o2)cc(c(c1O)CC=C(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Garcinone D, a natural xanthone from mangosteen, promotes the proliferation of C17.2 neural stem cell. Garcinone D increases the protein levels of phosphorylated signal transducer and activator of transcription 3 (p-STAT3), Cyclin D1 and nuclear factor erythroid 2-related factor (Nrf2), heme oxygenase-1 (HO-1) in concentration- and time- dependent manners[1]. |
| Target | p-STAT3 |
| Density | 1.304 |
| Boiling Point | 674.2±55.0 °C at 760 mmHg |
| Flash Point | 231.2±25.0 °C |
| Exact Mass | 428.183502 |
| PSA | 120.36000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |