Home
Products
Otophylloside B
| Product Name | Otophylloside B |
| Price: | $161 / 5mg |
| Catalog No.: | CN02380 |
| CAS No.: | 106758-54-7 |
| Molecular Formula: | C49H78O16 |
| Molecular Weight: | 923.13 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The roots of Cynanchum otophyllum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CO[C@H]1C[C@H](O[C@H]2CC[C@]3(C(=CC[C@@]4([C@@H]3C[C@@H](OC(=O)/C=C(/C(C)C)C)[C@]3([C@]4(O)CC[C@@]3(O)C(=O)C)C)O)C2)C)O[C@@H]([C@H]1O[C@H]1C[C@H](OC)[C@@H]([C@H](O1)C)O[C@H]1C[C@@H](OC)[C@@H]([C@H](O1)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Qingyangshengenin B, a C-21 steroidal glycoside isolated from Qingyangshen. Qingyangshengenin B protects against Aβ toxicity, which decreases Aβ deposition by decreasing the expression of Aβ at the mRNA level. Qingyangshengenin B has antiepileptic activity[1][2][3]. |
| Density | 1.3±0.1 g/cm3 |
| Boiling Point | 898.5±65.0 °C at 760 mmHg |
| Flash Point | 249.0±27.8 °C |
| Exact Mass | 922.528992 |
| LogP | 6.29 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Storage condition | 2-8℃ |