Home
Products
Matairesinol 4'-O-beta-gentiobioside
| Product Name | Matairesinol 4'-O-beta-gentiobioside |
| Price: | $467 / 5mg |
| Catalog No.: | CN02811 |
| CAS No.: | 106647-14-7 |
| Molecular Formula: | C32H42O16 |
| Molecular Weight: | 682.25 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The stem barks of Styrax japonica |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(OCC2OC(Oc3ccc(cc3OC)CC3C(=O)OCC3Cc3ccc(c(c3)OC)O)C(C(C2O)O)O)C(C(C1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Matairesinol 4′-O-β-D-glucopyranoside displays cytotoxic activity against HeLa cell line with an IC50 of 47.1 μM[1]. |
| Density | 1.5±0.0 g/cm3 |
| Boiling Point | 950.8±0.0 °C at 760 mmHg |
| Flash Point | 301.6±0.0 °C |
| Exact Mass | 682.247314 |
| PSA | 243.52000 |
| LogP | -1.32 |
| Vapour Pressure | 0.0±0.0 mmHg at 25°C |