Home
Products
7-Amino-4-methylcoumarin
| Product Name | 7-Amino-4-methylcoumarin |
| Price: | Inquiry |
| Catalog No.: | CN06196 |
| CAS No.: | 106562-32-7 |
| Molecular Formula: | C12H11NO4 |
| Molecular Weight: | 233.22 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Cryst. |
| Source: | The herbs of Guazuma ulmifolia |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | OC(=O)Cc1c(=O)oc2c(c1C)ccc(c2)N |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Amino-4-methylcoumarin-3-acetic acid is a fluorescent protein labelling agent. 7-Amino-4-methylcoumarin-3-acetic acid emits in the blue region (440-460 nm) on activation with UV light (350 nm)[1]. |
| Density | 1.391g/cm3 |
| Boiling Point | 512.2ºC at 760mmHg |
| Flash Point | 263.6ºC |
| Exact Mass | 233.06900 |
| PSA | 93.53000 |
| LogP | 1.89190 |
| Vapour Pressure | 2.58E-11mmHg at 25°C |