Home
Products
Sitostenone
| Product Name | Sitostenone |
| Price: | Inquiry |
| Catalog No.: | CN02603 |
| CAS No.: | 1058-61-3 |
| Molecular Formula: | C29H48O |
| Molecular Weight: | 412.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Cryst. |
| Source: | The roots of Xanthium sibiricum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC[C@@H](C(C)C)CC[C@H]([C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCC2=CC(=O)CC[C@]12C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | β-Sitostenone is a sterols that can be isolated from Cochlospermum vitifolium.β-Sitostenone inhibits tyrosinase activity, and has anti-melanogenic and anti-tumor activities[1][2][3]. |
| Target | Human Endogenous Metabolite |
| Density | 1.0±0.1 g/cm3 |
| Boiling Point | 503.8±17.0 °C at 760 mmHg |
| Flash Point | 263.7±11.8 °C |
| Exact Mass | 412.370514 |
| PSA | 17.07000 |
| LogP | 10.24 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |