Home
Products
Calceolarioside B
| Product Name | Calceolarioside B |
| Price: | $117 / 20mg |
| Catalog No.: | CN06871 |
| CAS No.: | 105471-98-5 |
| Molecular Formula: | C23H26O11 |
| Molecular Weight: | 478.45 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Ajuga becumbens Thunb. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | O=C(OCC1OC(OCCc2ccc(c(c2)O)O)C(C(C1O)O)O)C=Cc1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Calceolarioside B is a natural product isolated from Stauntonia hexaphylla leaves. Calceolarioside B exhibits significant inhibitory activity against rat lens aldose reductase (RLAR) with an IC50 of 23.99 μM. Calceolarioside B displays inhibitory effect on DPPH radical scavenging activity with an IC50 of 94.60 μM [1]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 799.8±60.0 °C at 760 mmHg |
| Flash Point | 275.2±26.4 °C |
| Exact Mass | 478.147522 |
| PSA | 186.37000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±3.0 mmHg at 25°C |
| Storage condition | 2~8℃ |