Home
Products
Aloeresin D
| Product Name | Aloeresin D |
| Price: | $366 / 10mg |
| Catalog No.: | CN04885 |
| CAS No.: | 105317-67-7 |
| Molecular Formula: | C29H32O11 |
| Molecular Weight: | 556.56 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Aloe arborescens Mill. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@H]([C@@H]([C@H]([C@@H]1O)O)O)c1c(OC)cc(c2c1oc(C[C@H](OC(=O)/C=C/c1ccc(cc1)O)C)cc2=O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Aloeresin D is a chromone glycoside isolated from Aloe vera, inhibits β-Secretase (BACE1) activity, with an IC50 of 39 μM[1]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 796.8±60.0 °C at 760 mmHg |
| Flash Point | 261.7±26.4 °C |
| Exact Mass | 556.194458 |
| PSA | 176.12000 |
| LogP | 2.98 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |