Home
Products
Geranylacetate
| Product Name | Geranylacetate |
| Price: | $18 / 50mg |
| Catalog No.: | CN09616 |
| CAS No.: | 105-87-3 |
| Molecular Formula: | C12H20O2 |
| Molecular Weight: | 196.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Monoterpenoids |
| Physical Desc.: | Oil |
| Source: | The volatile oil of the fruit from phellodendron Amurense Rupr. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C/C(=CCOC(=O)C)/CCC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Geranyl acetate, an acyclic monoterpene ester derived from geraniol, is widely used in the cosmetics industry due to its pleasant scent[1]. Geranyl acetate can induces cell apoptosis[2]. |
| In Vitro | Geranyl acetate exhibits significant anti-cancer activity against colo-205 cancer cell line with IC50 value of 30 μM[2]. Geranyl acetate induces apoptosis in colo-205 cells, this apoptosis is associated with upregulation of Bax and downregulation of Bcl-2 expressions[2]. |
| Density | 0.9±0.1 g/cm3 |
| Boiling Point | 247.5±0.0 °C at 760 mmHg |
| Flash Point | 98.9±0.0 °C |
| Exact Mass | 196.146332 |
| PSA | 26.30000 |
| LogP | 4.10 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Storage condition | 2-8°C |