Home
Products
Plantamajoside
| Product Name | Plantamajoside |
| Price: | $62 / 20mg |
| Catalog No.: | CN07019 |
| CAS No.: | 104777-68-6 |
| Molecular Formula: | C29H36O16 |
| Molecular Weight: | 640.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | White powder |
| Source: | The herbs of Plantago depressa Willd. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OCCc2ccc(c(c2)O)O)[C@@H]([C@H]([C@@H]1OC(=O)/C=C/c1ccc(c(c1)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Plantamajoside is a phenylpropanoid glycoside isolated from Plantago asiatica L.(Plantaginaceae). Plantamajoside has protective effects on LPS-induced acute lung injury (ALI) mice model. Plantamajoside has the potential for the treatment of pulmonary inflammation[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 953.0±65.0 °C at 760 mmHg |
| Flash Point | 308.5±27.8 °C |
| Exact Mass | 640.200317 |
| PSA | 265.52000 |
| LogP | -0.76 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2~8℃ |