Home
Products
Iriflophenone 3-C-beta-D-glucopyranoside
| Product Name | Iriflophenone 3-C-beta-D-glucopyranoside |
| Price: | $526 / 5mg |
| Catalog No.: | CN05850 |
| CAS No.: | 104669-02-5 |
| Molecular Formula: | C19H20O10 |
| Molecular Weight: | 408.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Xanthones |
| Physical Desc.: | Powder |
| Source: | The herbs of Aquilaria sinensis |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1OC(C(C(C1O)O)O)c1c(O)cc(c(c1O)C(=O)c1ccc(cc1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Iriflophenone 3-C-β-D-glucopyranoside, isolated from Cyclopia genistoides, has antioxidant activity[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 669.9±55.0 °C at 760 mmHg |
| Flash Point | 239.9±25.0 °C |
| Exact Mass | 408.105652 |
| PSA | 188.14000 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |