Home
Products
Typhaneoside
| Product Name | Typhaneoside |
| Price: | $77 / 20mg |
| Catalog No.: | CN05431 |
| CAS No.: | 104472-68-6 |
| Molecular Formula: | C34H42O20 |
| Molecular Weight: | 770.69 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Yellow powder |
| Source: | The herbs of Typha orientalis Presl. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | COc1cc(ccc1O)c1oc2cc(O)cc(c2c(=O)c1O[C@@H]1O[C@H](CO[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O[C@@H]2O[C@@H](C)[C@@H]([C@H]([C@H]2O)O)O)O)O)[C@H]([C@@H]([C@H]1O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Typhaneoside, extracted from Typha angustifolia L., Typhaneoside can inhibit the excessive autophagy of hypoxia/reoxygenation cells and increase the phosphorylation of Akt and mTOR. Typhaneoside has certain effects on the cardiovascular system, including lowering blood lipid levels, promoting antiatherosclerosis activities, as well as improving immune and coagulation function[1]. |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 1065.0±65.0 °C at 760 mmHg |
| Flash Point | 332.6±27.8 °C |
| Exact Mass | 770.226929 |
| PSA | 317.35000 |
| LogP | 2.27 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Storage condition | 2~8°C |