Home
Products
Nodosin
| Product Name | Nodosin |
| Price: | $290 / 10mg |
| Catalog No.: | CN08968 |
| CAS No.: | 10391-09-0 |
| Molecular Formula: | C20H26O6 |
| Molecular Weight: | 362.4 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Isodon serra |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | C=C1C2CC(C3C(C1=O)(C2)C(=O)OC1C23COC(C2C(CC1)(C)C)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Nodosin is a diterpenoid isolated from Isodon trichocarpus Kudo and I. Japonicus HARA[1]. |
| Density | 1.4±0.1 g/cm3 |
| Boiling Point | 615.3±55.0 °C at 760 mmHg |
| Flash Point | 222.1±25.0 °C |
| Exact Mass | 362.172943 |
| PSA | 93.06000 |
| LogP | -0.13 |
| Vapour Pressure | 0.0±4.0 mmHg at 25°C |