Home
Products
Procyanidin A1
| Product Name | Procyanidin A1 |
| Price: | $117 / 5mg |
| Catalog No.: | CN04740 |
| CAS No.: | 103883-03-0 |
| Molecular Formula: | C30H24O12 |
| Molecular Weight: | 576.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Daemonorops draco |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | Oc1cc(O)c2c(c1)OC1(C(C2c2c(O1)cc(c1c2OC(C(C1)O)c1ccc(c(c1)O)O)O)O)c1ccc(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Procyanidin A1 (Proanthocyanidin A1) is a procyanidin dimer, which inhibits degranulation downstream of protein kinase C activation or Ca2+ influx from an internal store in RBL-213 cells. Procyanidin A1 has antiallergic effects[1]. |
| In Vivo | Procyanidin A1 suppress serum IgE and IgG1 levels in mice-immunized with ovalbumin[2]. |
| Exact Mass | 576.12700 |
| PSA | 209.76000 |
| LogP | 2.79350 |