Home
Products
7-Prenylumbelliferone
| Product Name | 7-Prenylumbelliferone |
| Price: | $139 / 20mg |
| Catalog No.: | CN06136 |
| CAS No.: | 10387-50-5 |
| Molecular Formula: | C14H14O3 |
| Molecular Weight: | 230.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Coumarins |
| Physical Desc.: | Powder |
| Source: | The herbs of Heracleum dissectum |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC(=CCOc1ccc2c(c1)oc(=O)cc2)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 7-Prenyloxycoumarin (7-O-Prenylumbelliferone) is a secondary metabolite from the endophytic fungus of Annulohypoxylon ilanense[1]. |
| Density | 1.148g/cm3 |
| Boiling Point | 390.9ºC at 760mmHg |
| Flash Point | 164.9ºC |
| Exact Mass | 230.09400 |
| PSA | 39.44000 |
| LogP | 3.13800 |
| Vapour Pressure | 2.56E-06mmHg at 25°C |