Home
Products
Ganoderic acid C2
| Product Name | Ganoderic acid C2 |
| Price: | $161 / 5mg |
| Catalog No.: | CN07728 |
| CAS No.: | 103773-62-2 |
| Molecular Formula: | C30H46O7 |
| Molecular Weight: | 518.7 g/mol |
| Purity: | >=98% |
| Type of Compound: | Triterpenoids |
| Physical Desc.: | Powder |
| Source: | The fruit body of Ganoderma lucidum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(C[C@H](C(=O)O)C)C[C@H]([C@H]1C[C@@H]([C@@]2([C@]1(C)CC(=O)C1=C2[C@@H](O)C[C@@H]2[C@]1(C)CC[C@@H](C2(C)C)O)C)O)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Ganoderic acid C2 is a bioactive triterpenoid in Ganoderma lucidum. Ganoderic acid C2 possesses the potential anti-tumor bioactivity, antihistamine, anti-aging and cytotoxic effects. Ganoderic acid C2 exhibits high inhibitory activity against the rat lens aldose reductase (RLAR) with an IC50 of 3.8 µM[1][2]. |
| Target | IC50: 3.8 µM (RLAR)[2] |
| Density | 1.22±0.1 g/cm3(Predicted) |
| Boiling Point | 690.8±55.0 °C(Predicted) |
| Exact Mass | 518.32400 |
| PSA | 132.13000 |
| LogP | 3.92330 |