Home
Products
Mirificin
| Product Name | Mirificin |
| Price: | $117 / 10mg |
| Catalog No.: | CN04904 |
| CAS No.: | 103654-50-8 |
| Molecular Formula: | C26H28O13 |
| Molecular Weight: | 548.49 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | The roots of Pueraria lobata |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OCC1(O)COC(C1O)OCC1OC(C(C(C1O)O)O)c1c(O)ccc2c1occ(c2=O)c1ccc(cc1)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Mirificin (Puerarin apioside) is a isoflavone in Puerariae Lobatae Radix. Mirificin inhibits tyrosinase (TYR) with an IC50 of 12.66 μM[1]. |
| Target | IC50: 12.66 μM (TYR)[1] |
| Density | 1.7±0.1 g/cm3 |
| Boiling Point | 848.0±65.0 °C at 760 mmHg |
| Flash Point | 285.8±27.8 °C |
| Exact Mass | 548.153015 |
| PSA | 219.74000 |
| LogP | 1.21 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Storage condition | 2-8℃ |