Home
Products
5,7-Dimethoxyflavanone
| Product Name | 5,7-Dimethoxyflavanone |
| Price: | Inquiry |
| Catalog No.: | CN05015 |
| CAS No.: | 1036-72-2 |
| Molecular Formula: | C17H16O4 |
| Molecular Weight: | 284.3 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Cryst. |
| Source: | The stem barks of Uvaria mocoli |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc2OC(CC(=O)c2c(c1)OC)c1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | 5,7-Dimethoxyflavanone is an active compound. 5,7-Dimethoxyflavanone can be Isolated from the roots of Zanthoxylum nitidum[1]. |
| Density | 1.204g/cm3 |
| Boiling Point | 468.8ºC at 760mmHg |
| Flash Point | 209.4ºC |
| Exact Mass | 284.10500 |
| PSA | 44.76000 |
| LogP | 3.41030 |
| Vapour Pressure | 5.79E-09mmHg at 25°C |