Home
Products
Huperzine B
| Product Name | Huperzine B |
| Price: | $92 / 20mg |
| Catalog No.: | CN02122 |
| CAS No.: | 103548-82-9 |
| Molecular Formula: | C16H20N2O |
| Molecular Weight: | 256.35 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Lycopodium serratum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC1=CC2Cc3c(C4(C1)C2CCCN4)ccc(=O)[nH]3 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Huperzine B is a Lycopodium alkaloid isolated from Huperzia serrata and a highly selective acetylcholinesterase (AChE) inhibitor. Huperzine B can be uesd to can be used to improve Alzheimer's disease[1][2]. |
| Target | AChE[1] |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 533.5±50.0 °C at 760 mmHg |
| Flash Point | 216.4±30.3 °C |
| Exact Mass | 256.157562 |
| PSA | 44.89000 |
| LogP | 1.98 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |