Home
Products
Phyllanthin
| Product Name | Phyllanthin |
| Price: | $409 / 5mg |
| Catalog No.: | CN03004 |
| CAS No.: | 10351-88-9 |
| Molecular Formula: | C24H34O6 |
| Molecular Weight: | 418.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The herbs of Phyllanthus niruri L. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COC[C@H]([C@H](Cc1ccc(c(c1)OC)OC)COC)Cc1ccc(c(c1)OC)OC |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Phyllanthin is a major bioactive lignan component of Phyllanthus amarus. Phyllanthin exhibits high antioxidative and hepatoprotective properties[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 530.6±50.0 °C at 760 mmHg |
| Flash Point | 207.3±30.0 °C |
| Exact Mass | 418.235535 |
| PSA | 55.38000 |
| LogP | 4.11 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 2-8℃ |