Home
Products
Octyl Gallate
| Product Name | Octyl Gallate |
| Price: | $18 / 20mg |
| Catalog No.: | CN03456 |
| CAS No.: | 1034-01-1 |
| Molecular Formula: | C15H22O5 |
| Molecular Weight: | 282.33 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | From Rhus chinensis Mill. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CCCCCCCCOC(=O)c1cc(O)c(c(c1)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Octyl gallate (Progallin O) is widely used as a food additive, with antimicrobial and antioxidant activity[1][2]. Octyl gallate (Progallin O) shows selective and sensitive fluorescent property[2]. |
| In Vitro | Octyl gallate has antimicrobial activity over H. pylori, with a minimum inhibitory concentration (MIC) value of 125 µg/mL[1]. |
| Density | 1.2±0.1 g/cm3 |
| Boiling Point | 482.9±40.0 °C at 760 mmHg |
| Flash Point | 177.1±20.8 °C |
| Exact Mass | 282.146729 |
| PSA | 86.99000 |
| LogP | 5.26 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Storage condition | 0-6°C |