Home
Products
D-Arabinose
| Product Name | D-Arabinose |
| Price: | $15 / 20mg |
| Catalog No.: | CN06531 |
| CAS No.: | 10323-20-3 |
| Molecular Formula: | C5H10O5 |
| Molecular Weight: | 150.1 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The herbs of Rehmannia glutinosa |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]([C@H]([C@@H](C=O)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Density | 1.8±0.1 g/cm3 |
| Boiling Point | 333.2±42.0 °C at 760 mmHg |
| Flash Point | 155.3±27.9 °C |
| Exact Mass | 150.052826 |
| PSA | 97.99000 |
| LogP | -0.83 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |