Home
Products
Benzyl cinnamate
| Product Name | Benzyl cinnamate |
| Price: | $15 / 50mg |
| Catalog No.: | CN06968 |
| CAS No.: | 103-41-3 |
| Molecular Formula: | C16H14O2 |
| Molecular Weight: | 238.28 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenylpropanoids |
| Physical Desc.: | Powder |
| Source: | The barks of Cinnamomum cassia Presl |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O=C(/C=C/c1ccccc1)OCc1ccccc1 |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Benzyl cinnamate, occurs in Balsam of Peru and Tolu balsam, in Sumatra and Penang benzoin, and as the main constituent of copaiba balsam, is used in heavy oriental perfumes and as a fixative[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 195-200 ºC (5 mmHg) |
| Flash Point | 225.7±10.4 °C |
| Exact Mass | 238.099380 |
| PSA | 26.30000 |
| LogP | 3.65 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |