Home
Products
Intermedine
| Product Name | Intermedine |
| Price: | Inquiry |
| Catalog No.: | CN01613 |
| CAS No.: | 10285-06-0 |
| Molecular Formula: | C15H25NO5 |
| Molecular Weight: | 299.36 g/mol |
| Purity: | >=98% |
| Type of Compound: | Alkaloids |
| Physical Desc.: | Powder |
| Source: | The herbs of Symphytum uplandicum. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | O[C@@H]1CCN2[C@@H]1C(=CC2)COC(=O)[C@@]([C@H](O)C)(C(C)C)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | (+)-Intermedine, a pyrrolizidine alkaloid (PA), exhibits significant cytotoxicity in neural progenitor cells (NPCs)[1]. |
| In Vitro | (+)-Intermedine (1.1-30 μM; 24 hours) exhibits significant cytotoxicity at 30 μM and reduces cell viability in a concentration dependent manner in neural progenitor cells (NPCs)[1]. (+)-Intermedine showsno differentiation impairment[1]. Cell Cytotoxicity Assay[1] Cell Line: Neural progenitor cells (NPCs) Concentration: 1.1, 3.3, 10, 30 μM Incubation Time: 24 hours Result: Exhibited significant cytotoxicity at 30 μM and reduced cell viability in a concentration dependent manner. |
| Density | 1.26g/cm3 |
| Boiling Point | 463.3ºC at 760mmHg |
| Flash Point | 234ºC |
| Exact Mass | 299.17300 |
| PSA | 90.23000 |
| Vapour Pressure | 1.57E-10mmHg at 25°C |