Home
Products
Mulberroside C
| Product Name | Mulberroside C |
| Price: | $293 / 20mg |
| Catalog No.: | CN04103 |
| CAS No.: | 102841-43-0 |
| Molecular Formula: | C24H26O9 |
| Molecular Weight: | 458.46 g/mol |
| Purity: | >=98% |
| Type of Compound: | Phenols |
| Physical Desc.: | Powder |
| Source: | The root barks of Morus alba L. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc(O[C@@H]2OC[C@H]([C@@H]([C@H]2O)O)O)cc(c1)c1oc2c(c1)cc1c(c2)OC(C(C1)O)(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Mulberroside C is one of the main bioactive constituents in mulberry (Morus alba L.)[1]. Mulberroside C is a HCV replicon inhibitor. Antiviral activity[2]. |
| Density | 1.5±0.1 g/cm3 |
| Boiling Point | 735.5±60.0 °C at 760 mmHg |
| Flash Point | 398.6±32.9 °C |
| Exact Mass | 458.157684 |
| PSA | 141.98000 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Storage condition | 2-8℃ |