Home
Products
D-Pinitol
| Product Name | D-Pinitol |
| Price: | $40 / 20mg |
| Catalog No.: | CN06744 |
| CAS No.: | 10284-63-6 |
| Molecular Formula: | C7H14O6 |
| Molecular Weight: | 194.2 g/mol |
| Purity: | >=98% |
| Type of Compound: | Miscellaneous |
| Physical Desc.: | Powder |
| Source: | The barks of Acacia nilotica |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | CO[C@@H]1[C@@H](O)[C@@H](O)[C@@H]([C@@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | D-pinitol (3-O-Methyl-D-chiro-inositol) is a natural compound presented in several plants, like Pinaceae and Leguminosae plants. D-pinitol exerts hypoglycemic activity and protective effects in the cardiovascular system[1][2]. |
| In Vitro | D-pinitol promotes apoptosis in MCF-7 cells via induction of p53 and Bax and inhibition of Bcl-2 and NF-κB[3]. |
| Density | 1.6±0.1 g/cm3 |
| Boiling Point | 317.2±42.0 °C at 760 mmHg |
| Flash Point | 145.6±27.9 °C |
| Exact Mass | 194.079041 |
| PSA | 110.38000 |
| LogP | -0.74 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |