Home
Products
Kushenol N
| Product Name | Kushenol N |
| Price: | Inquiry |
| Catalog No.: | CN05152 |
| CAS No.: | 102490-65-3 |
| Molecular Formula: | C26H30O7 |
| Molecular Weight: | 454.5 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Cryst. |
| Source: | The roots of Sophora flavescens Ait. |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | COc1cc(O)c(c2c1C(=O)[C@@H](O)[C@H](O2)c1ccc(cc1O)O)C[C@H](C(=C)C)CC=C(C)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Kushenol N is a prenylated flavonoid that can be isolated from the root of Sophora flavescens. Kushenol N has anti-allergic and vasorelaxation activities[1][2]. |
| Density | 1.27g/cm3 |
| Boiling Point | 690.029ºC at 760 mmHg |
| Flash Point | 232.386ºC |
| Exact Mass | 454.19900 |
| PSA | 116.45000 |
| LogP | 4.58040 |
| Vapour Pressure | 0mmHg at 25°C |