Home
Products
Negsehisandrin G
| Product Name | Negsehisandrin G |
| Price: | $263 / 10mg |
| Catalog No.: | CN02863 |
| CAS No.: | 1023744-69-5 |
| Molecular Formula: | C28H36O7 |
| Molecular Weight: | 484.6 g/mol |
| Purity: | >=98% |
| Type of Compound: | Lignans |
| Physical Desc.: | Powder |
| Source: | The fruits of Schisandra neglecta A. C. Smith |
| Solvent: | Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc. |
| SMILES: | CC=C(C(=O)Oc1c(OC)c(OC)cc2c1c1c(CC(C(C2)C)C)cc(c(c1OC)OC)OC)C |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Angeloyl-(+)-gomisin K3 is a dibenzocyclooctane lignan[1]. |
| Density | 1.1±0.1 g/cm3 |
| Boiling Point | 625.8±55.0 °C at 760 mmHg |
| Flash Point | 264.5±31.5 °C |
| Exact Mass | 484.246094 |
| PSA | 72.45000 |
| LogP | 6.61 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |