Home
Products
Atractyloside potassium salt
| Product Name | Atractyloside potassium salt |
| Price: | $117 / 10mg |
| Catalog No.: | CN08828 |
| CAS No.: | 102130-43-8 |
| Molecular Formula: | C30H44K2O16S2 |
| Molecular Weight: | 802.99 g/mol |
| Purity: | >=98% |
| Type of Compound: | Diterpenoids |
| Physical Desc.: | Powder |
| Source: | The herbs of Atractylis gummifera |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](O[C@@H]2CC(C(=O)[O-])[C@@H]3[C@](C2)(C)[C@@H]2CC[C@@H]4C[C@@]2(CC3)[C@@H](O)C4=C)[C@@H]([C@H]([C@@H]1OS(=O)(=O)[O-])OS(=O)(=O)O)OC(=O)CC(C)C.[K+].[K+] |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Atractyloside potassium salt is a toxic diterpenoid glycoside isolated from the fruits of Xanthium sibiricum. Atractyloside potassium salt is a powerful and specific inhibitor of mitochondrial ADP/ATP transport. Atractyloside potassium salt inhibits chloride channels from mitochondrial membranes of rat heart[1][2][3]. |
| Exact Mass | 802.134460 |
| PSA | 272.14000 |
| LogP | 3.14340 |
| Storage condition | 2-8°C |