Home
Products
Pseudoprotodioscin
| Product Name | Pseudoprotodioscin |
| Price: | $74 / 20mg |
| Catalog No.: | CN02426 |
| CAS No.: | 102115-79-7 |
| Molecular Formula: | C51H82O2 |
| Molecular Weight: | 1031.18 g/mol |
| Purity: | >=98% |
| Type of Compound: | Steroids |
| Physical Desc.: | Powder |
| Source: | The rhizomes of Dioscorea nipponica Makino. |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | OC[C@H]1O[C@@H](OC2CC[C@]3(C(=CC[C@@H]4[C@@H]3CC[C@]3([C@H]4C[C@H]4[C@@H]3C(=C(O4)CC[C@H](CO[C@@H]3O[C@H](CO)[C@H]([C@@H]([C@H]3O)O)O)C)C)C)C2)C)[C@@H]([C@H]([C@@H]1O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O)O)O[C@@H]1O[C@@H](C)[C@@H]([C@H]([C@H]1O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Pseudoprotodioscin, a furostanoside, inhibits SREBP1/2 and microRNA 33a/b levels and reduces the gene expression regarding the synthesis of cholesterol and triglycerides[1]. |
| In Vitro | In Hep G2 cells, Pseudoprotodioscin increases ABCA1 protein and mRNA levels, and promotes the effluxion of ApoA-1-mediated cholesterol. Pseudoprotodioscin inhibits SREBP1c and SREBP2 transcription by decreasing microRNA 33a/b levels. This procedure reciprocally lead to the increase of ABCA1 levels. In THP-1 macrophages, Pseudoprotodioscin shows the similar effect, which reduces HMGCR, FAS and ACC mRNA levels and promotes low density lipoprotein receptor by decreasing the PCSK9 levels[1]. |
| Density | 1.45 g/cm3 |
| Exact Mass | 1030.534912 |
| PSA | 325.83000 |
| LogP | 5.31 |