Home
Products
Epitheaflagallin 3-O-gallate
| Product Name | Epitheaflagallin 3-O-gallate |
| Price: | Inquiry |
| Catalog No.: | CN04508 |
| CAS No.: | 102067-92-5 |
| Molecular Formula: | C27H20O13 |
| Molecular Weight: | 552.44 g/mol |
| Purity: | >=98% |
| Type of Compound: | Flavonoids |
| Physical Desc.: | Powder |
| Source: | From Black tea |
| Solvent: | DMSO, Pyridine, Methanol, Ethanol, etc. |
| SMILES: | Oc1cc2O[C@@H]([C@@H](Cc2c(c1)O)OC(=O)c1cc(O)c(c(c1)O)O)c1cc2cc(O)c(c(c2c(=O)c(c1)O)O)O |
| Contact us | |
|---|---|
| First Name: | |
| Last Name: | |
| E-mail: | |
| Question: | |
| Description | Epitheaflagallin 3-O-gallate is a minor polyphenol in black tea. Epitheaflagallin 3-O-gallate exhibits versatile physiological functions in vivo and in vitro, including antioxidative activity, pancreatic lipase inhibition, Streptococcus sorbinusglycosyltransferase inhibition, and an inhibiting effect on the activity of matrix metalloprotease-1 and -3 and their synthesis by human gingival fibroblasts[1]. |
| Exact Mass | 552.09000 |
| PSA | 234.67000 |
| LogP | 2.45220 |